C22H10Cl2N4O3 — CID 168735507
5,6-dichloro-2-[[5-(4-isocyanophenyl)-4-methylimidazo[4,5-d][1,3]oxazol-2-yl]methylidene]indene-1,3-dione (PubChem CID 168735507) has the molecular formula C22H10Cl2N4O3 and a molecular weight of 449.25 g/mol. Its IUPAC name is 5,6-dichloro-2-[[5-(4-isocyanophenyl)-4-methylimidazo[4,5-d][1,3]oxazol-2-yl]methylidene]indene-1,3-dione.
| Compound Name | 5,6-dichloro-2-[[5-(4-isocyanophenyl)-4-methylimidazo[4,5-d][1,3]oxazol-2-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 168735507 |
| Molecular Formula | C22H10Cl2N4O3 |
| Molecular Weight | 449.25 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | 5,6-dichloro-2-[[5-(4-isocyanophenyl)-4-methylimidazo[4,5-d][1,3]oxazol-2-yl]methylidene]indene-1,3-dione |
| SMILES | [C-]#[N+]c1ccc(-c2nc3oc(C=C4C(=O)c5cc(Cl)c(Cl)cc5C4=O)nc3n2C)cc1 |
| InChI | InChI=1S/C22H10Cl2N4O3/c1-25-11-5-3-10(4-6-11)20-27-22-21(28(20)2)26-17(31-22)9-14-18(29)12-7-15(23)16(24)8-13(12)19(14)30/h3-9H,2H3 |
| InChIKey | HPHQVWZUKAOZPD-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.25 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|