C25H13Br2N3O2S — CID 168735859
6,7-dibromo-2-[(4-methyl-5-phenylimidazo[4,5-d][1,3]thiazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 168735859) has the molecular formula C25H13Br2N3O2S and a molecular weight of 579.27 g/mol. Its IUPAC name is 6,7-dibromo-2-[(4-methyl-5-phenylimidazo[4,5-d][1,3]thiazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 6,7-dibromo-2-[(4-methyl-5-phenylimidazo[4,5-d][1,3]thiazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 168735859 |
| Molecular Formula | C25H13Br2N3O2S |
| Molecular Weight | 579.27 g/mol |
| Exact Mass | 576.91 |
| IUPAC Name | 6,7-dibromo-2-[(4-methyl-5-phenylimidazo[4,5-d][1,3]thiazol-2-yl)methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | Cn1c(-c2ccccc2)nc2sc(C=C3C(=O)c4cc5cc(Br)c(Br)cc5cc4C3=O)nc21 |
| InChI | InChI=1S/C25H13Br2N3O2S/c1-30-23(12-5-3-2-4-6-12)29-25-24(30)28-20(33-25)11-17-21(31)15-7-13-9-18(26)19(27)10-14(13)8-16(15)22(17)32/h2-11H,1H3 |
| InChIKey | MVUIQEPZUVICSE-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.27 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|