C20H12N4O2S — CID 168735762
6-[(4-methyl-5-phenylpyrrolo[2,3-d][1,3]thiazol-2-yl)methylidene]cyclopenta[b]pyrazine-5,7-dione (PubChem CID 168735762) has the molecular formula C20H12N4O2S and a molecular weight of 372.41 g/mol. Its IUPAC name is 6-[(4-methyl-5-phenylpyrrolo[2,3-d][1,3]thiazol-2-yl)methylidene]cyclopenta[b]pyrazine-5,7-dione.
| Compound Name | 6-[(4-methyl-5-phenylpyrrolo[2,3-d][1,3]thiazol-2-yl)methylidene]cyclopenta[b]pyrazine-5,7-dione |
|---|---|
| PubChem CID | 168735762 |
| Molecular Formula | C20H12N4O2S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 6-[(4-methyl-5-phenylpyrrolo[2,3-d][1,3]thiazol-2-yl)methylidene]cyclopenta[b]pyrazine-5,7-dione |
| SMILES | Cn1c(-c2ccccc2)cc2sc(C=C3C(=O)c4nccnc4C3=O)nc21 |
| InChI | InChI=1S/C20H12N4O2S/c1-24-13(11-5-3-2-4-6-11)10-14-20(24)23-15(27-14)9-12-18(25)16-17(19(12)26)22-8-7-21-16/h2-10H,1H3 |
| InChIKey | JCSBWQVPTKUIDO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|