C27H13N3O4S2 — CID 164971072
(3Z)-3-[[10-[(Z)-(2,3-dioxoinden-1-ylidene)methyl]-7-methyl-3,11-dithia-5,7,9-triazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]indene-1,2-dione (PubChem CID 164971072) has the molecular formula C27H13N3O4S2 and a molecular weight of 507.55 g/mol. Its IUPAC name is (3Z)-3-[[10-[(Z)-(2,3-dioxoinden-1-ylidene)methyl]-7-methyl-3,11-dithia-5,7,9-triazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]indene-1,2-dione.
| Compound Name | (3Z)-3-[[10-[(Z)-(2,3-dioxoinden-1-ylidene)methyl]-7-methyl-3,11-dithia-5,7,9-triazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]indene-1,2-dione |
|---|---|
| PubChem CID | 164971072 |
| Molecular Formula | C27H13N3O4S2 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | (3Z)-3-[[10-[(Z)-(2,3-dioxoinden-1-ylidene)methyl]-7-methyl-3,11-dithia-5,7,9-triazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]methylidene]indene-1,2-dione |
| SMILES | Cn1c2nc(/C=C3\C(=O)C(=O)c4ccccc43)sc2c2sc(/C=C3\C(=O)C(=O)c4ccccc43)nc21 |
| InChI | InChI=1S/C27H13N3O4S2/c1-30-26-24(35-18(28-26)10-16-12-6-2-4-8-14(12)20(31)22(16)33)25-27(30)29-19(36-25)11-17-13-7-3-5-9-15(13)21(32)23(17)34/h2-11H,1H3/b16-10-,17-11- |
| InChIKey | RKBHPUSTIQMOMR-APGQMXJTSA-N |
| XLogP | 4.86 |
| TPSA | 98.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|