C34H20N2O4S2 — CID 164956287
2-[[2-[(1,3-dioxoinden-2-ylidene)methyl]-5,10-dimethyl-3b,8b-dihydro-[1,3]benzothiazolo[7,6-g][1,3]benzothiazol-7-yl]methylidene]indene-1,3-dione (PubChem CID 164956287) has the molecular formula C34H20N2O4S2 and a molecular weight of 584.68 g/mol. Its IUPAC name is 2-[[2-[(1,3-dioxoinden-2-ylidene)methyl]-5,10-dimethyl-3b,8b-dihydro-[1,3]benzothiazolo[7,6-g][1,3]benzothiazol-7-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[2-[(1,3-dioxoinden-2-ylidene)methyl]-5,10-dimethyl-3b,8b-dihydro-[1,3]benzothiazolo[7,6-g][1,3]benzothiazol-7-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 164956287 |
| Molecular Formula | C34H20N2O4S2 |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.09 |
| IUPAC Name | 2-[[2-[(1,3-dioxoinden-2-ylidene)methyl]-5,10-dimethyl-3b,8b-dihydro-[1,3]benzothiazolo[7,6-g][1,3]benzothiazol-7-yl]methylidene]indene-1,3-dione |
| SMILES | CC1=CC2c3sc(C=C4C(=O)c5ccccc5C4=O)nc3C(C)=CC2c2sc(C=C3C(=O)c4ccccc4C3=O)nc21 |
| InChI | InChI=1S/C34H20N2O4S2/c1-15-11-21-22(33-27(15)35-25(41-33)13-23-29(37)17-7-3-4-8-18(17)30(23)38)12-16(2)28-34(21)42-26(36-28)14-24-31(39)19-9-5-6-10-20(19)32(24)40/h3-14,21-22H,1-2H3 |
| InChIKey | CYVWKHHITQXINU-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 94.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|