C48H28N2O8S2 — CID 167054150
dibenzyl 2,7-bis[(Z)-(2,3-dioxoinden-1-ylidene)methyl]-3b,8b-dihydro-[1,3]benzothiazolo[7,6-g][1,3]benzothiazole-5,10-dicarboxylate (PubChem CID 167054150) has the molecular formula C48H28N2O8S2 and a molecular weight of 824.89 g/mol. Its IUPAC name is dibenzyl 2,7-bis[(Z)-(2,3-dioxoinden-1-ylidene)methyl]-3b,8b-dihydro-[1,3]benzothiazolo[7,6-g][1,3]benzothiazole-5,10-dicarboxylate.
| Compound Name | dibenzyl 2,7-bis[(Z)-(2,3-dioxoinden-1-ylidene)methyl]-3b,8b-dihydro-[1,3]benzothiazolo[7,6-g][1,3]benzothiazole-5,10-dicarboxylate |
|---|---|
| PubChem CID | 167054150 |
| Molecular Formula | C48H28N2O8S2 |
| Molecular Weight | 824.89 g/mol |
| Exact Mass | 824.13 |
| IUPAC Name | dibenzyl 2,7-bis[(Z)-(2,3-dioxoinden-1-ylidene)methyl]-3b,8b-dihydro-[1,3]benzothiazolo[7,6-g][1,3]benzothiazole-5,10-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)C1=CC2c3sc(/C=C4\C(=O)C(=O)c5ccccc54)nc3C(C(=O)OCc3ccccc3)=CC2c2sc(/C=C3\C(=O)C(=O)c4ccccc43)nc21 |
| InChI | InChI=1S/C48H28N2O8S2/c51-41-29-17-9-7-15-27(29)31(43(41)53)21-37-49-39-35(47(55)57-23-25-11-3-1-4-12-25)19-33-34(45(39)59-37)20-36(48(56)58-24-26-13-5-2-6-14-26)40-46(33)60-38(50-40)22-32-28-16-8-10-18-30(28)42(52)44(32)54/h1-22,33-34H,23-24H2/b31-21-,32-22- |
| InChIKey | SNFCNJOLFNSPKL-RYJWMXFHSA-N |
| XLogP | 8.36 |
| TPSA | 146.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.89 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|