C44H21N5O6S2 — CID 167050945
benzyl 9,14-bis[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]-10,13-dithia-3,4,5,8,15-pentazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaene-4-carboxylate (PubChem CID 167050945) has the molecular formula C44H21N5O6S2 and a molecular weight of 779.82 g/mol. Its IUPAC name is benzyl 9,14-bis[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]-10,13-dithia-3,4,5,8,15-pentazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaene-4-carboxylate.
| Compound Name | benzyl 9,14-bis[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]-10,13-dithia-3,4,5,8,15-pentazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaene-4-carboxylate |
|---|---|
| PubChem CID | 167050945 |
| Molecular Formula | C44H21N5O6S2 |
| Molecular Weight | 779.82 g/mol |
| Exact Mass | 779.09 |
| IUPAC Name | benzyl 9,14-bis[(1,3-dioxocyclopenta[b]naphthalen-2-ylidene)methyl]-10,13-dithia-3,4,5,8,15-pentazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaene-4-carboxylate |
| SMILES | O=C1C(=Cc2nc3c4nn(C(=O)OCc5ccccc5)nc4c4nc(C=C5C(=O)c6cc7ccccc7cc6C5=O)sc4c3s2)C(=O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C44H21N5O6S2/c50-38-26-14-22-10-4-5-11-23(22)15-27(26)39(51)30(38)18-32-45-36-34-35(48-49(47-34)44(54)55-20-21-8-2-1-3-9-21)37-43(42(36)56-32)57-33(46-37)19-31-40(52)28-16-24-12-6-7-13-25(24)17-29(28)41(31)53/h1-19H,20H2 |
| InChIKey | JZAUVBMXPOZRRO-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 151.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.82 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|