C40H15N5O6S2 — CID 167050811
benzyl 4,10-bis[(5,6-dicyano-1,3-dioxoinden-2-ylidene)methyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7-carboxylate (PubChem CID 167050811) has the molecular formula C40H15N5O6S2 and a molecular weight of 725.72 g/mol. Its IUPAC name is benzyl 4,10-bis[(5,6-dicyano-1,3-dioxoinden-2-ylidene)methyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7-carboxylate.
| Compound Name | benzyl 4,10-bis[(5,6-dicyano-1,3-dioxoinden-2-ylidene)methyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7-carboxylate |
|---|---|
| PubChem CID | 167050811 |
| Molecular Formula | C40H15N5O6S2 |
| Molecular Weight | 725.72 g/mol |
| Exact Mass | 725.05 |
| IUPAC Name | benzyl 4,10-bis[(5,6-dicyano-1,3-dioxoinden-2-ylidene)methyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7-carboxylate |
| SMILES | N#Cc1cc2c(cc1C#N)C(=O)C(=Cc1cc3c(s1)c1sc(C=C4C(=O)c5cc(C#N)c(C#N)cc5C4=O)cc1n3C(=O)OCc1ccccc1)C2=O |
| InChI | InChI=1S/C40H15N5O6S2/c41-14-20-6-26-27(7-21(20)15-42)35(47)30(34(26)46)10-24-12-32-38(52-24)39-33(45(32)40(50)51-18-19-4-2-1-3-5-19)13-25(53-39)11-31-36(48)28-8-22(16-43)23(17-44)9-29(28)37(31)49/h1-13H,18H2 |
| InChIKey | KYGFAWIJEINAAT-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 194.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.72 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|