C40H17F6N3O6S2 — CID 167051078
benzyl 9,14-bis[(Z)-[2,3-dioxo-5-(trifluoromethyl)inden-1-ylidene]methyl]-10,13-dithia-3,4,5-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaene-4-carboxylate (PubChem CID 167051078) has the molecular formula C40H17F6N3O6S2 and a molecular weight of 813.71 g/mol. Its IUPAC name is benzyl 9,14-bis[(Z)-[2,3-dioxo-5-(trifluoromethyl)inden-1-ylidene]methyl]-10,13-dithia-3,4,5-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaene-4-carboxylate.
| Compound Name | benzyl 9,14-bis[(Z)-[2,3-dioxo-5-(trifluoromethyl)inden-1-ylidene]methyl]-10,13-dithia-3,4,5-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaene-4-carboxylate |
|---|---|
| PubChem CID | 167051078 |
| Molecular Formula | C40H17F6N3O6S2 |
| Molecular Weight | 813.71 g/mol |
| Exact Mass | 813.05 |
| IUPAC Name | benzyl 9,14-bis[(Z)-[2,3-dioxo-5-(trifluoromethyl)inden-1-ylidene]methyl]-10,13-dithia-3,4,5-triazatetracyclo[10.3.0.02,6.07,11]pentadeca-1(12),2,5,7(11),8,14-hexaene-4-carboxylate |
| SMILES | O=C1C(=O)c2cc(C(F)(F)F)ccc2/C1=C/c1cc2c3nn(C(=O)OCc4ccccc4)nc3c3cc(/C=C4\C(=O)C(=O)c5cc(C(F)(F)F)ccc54)sc3c2s1 |
| InChI | InChI=1S/C40H17F6N3O6S2/c41-39(42,43)18-6-8-22-24(10-18)32(50)34(52)26(22)12-20-14-28-30-31(48-49(47-30)38(54)55-16-17-4-2-1-3-5-17)29-15-21(57-37(29)36(28)56-20)13-27-23-9-7-19(40(44,45)46)11-25(23)33(51)35(27)53/h1-15H,16H2/b26-12-,27-13- |
| InChIKey | UVRWWKYMLOYJHZ-KTDSDSLMSA-N |
| XLogP | 9.70 |
| TPSA | 125.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.71 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|