C50H24F6N2O8S2 — CID 167050906
dibenzyl 2,7-bis[(Z)-[2,3-dioxo-5-(trifluoromethyl)inden-1-ylidene]methyl]-[1,3]benzothiazolo[7,6-g][1,3]benzothiazole-5,10-dicarboxylate (PubChem CID 167050906) has the molecular formula C50H24F6N2O8S2 and a molecular weight of 958.87 g/mol. Its IUPAC name is dibenzyl 2,7-bis[(Z)-[2,3-dioxo-5-(trifluoromethyl)inden-1-ylidene]methyl]-[1,3]benzothiazolo[7,6-g][1,3]benzothiazole-5,10-dicarboxylate.
| Compound Name | dibenzyl 2,7-bis[(Z)-[2,3-dioxo-5-(trifluoromethyl)inden-1-ylidene]methyl]-[1,3]benzothiazolo[7,6-g][1,3]benzothiazole-5,10-dicarboxylate |
|---|---|
| PubChem CID | 167050906 |
| Molecular Formula | C50H24F6N2O8S2 |
| Molecular Weight | 958.87 g/mol |
| Exact Mass | 958.09 |
| IUPAC Name | dibenzyl 2,7-bis[(Z)-[2,3-dioxo-5-(trifluoromethyl)inden-1-ylidene]methyl]-[1,3]benzothiazolo[7,6-g][1,3]benzothiazole-5,10-dicarboxylate |
| SMILES | O=C1C(=O)c2cc(C(F)(F)F)ccc2/C1=C/c1nc2c(C(=O)OCc3ccccc3)cc3c(cc(C(=O)OCc4ccccc4)c4nc(/C=C5\C(=O)C(=O)c6cc(C(F)(F)F)ccc65)sc43)c2s1 |
| InChI | InChI=1S/C50H24F6N2O8S2/c51-49(52,53)25-11-13-27-29(15-25)41(59)43(61)31(27)19-37-57-39-35(47(63)65-21-23-7-3-1-4-8-23)17-33-34(45(39)67-37)18-36(48(64)66-22-24-9-5-2-6-10-24)40-46(33)68-38(58-40)20-32-28-14-12-26(50(54,55)56)16-30(28)42(60)44(32)62/h1-20H,21-22H2/b31-19-,32-20- |
| InChIKey | PNFBXEPITSGBFZ-CDSIFPFTSA-N |
| XLogP | 11.42 |
| TPSA | 146.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 958.87 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|