C52H26F6O8S2 — CID 167050804
dibenzyl 2,7-bis[(Z)-[2,3-dioxo-5-(trifluoromethyl)inden-1-ylidene]methyl]-[1]benzothiolo[7,6-g][1]benzothiole-5,10-dicarboxylate (PubChem CID 167050804) has the molecular formula C52H26F6O8S2 and a molecular weight of 956.89 g/mol. Its IUPAC name is dibenzyl 2,7-bis[(Z)-[2,3-dioxo-5-(trifluoromethyl)inden-1-ylidene]methyl]-[1]benzothiolo[7,6-g][1]benzothiole-5,10-dicarboxylate.
| Compound Name | dibenzyl 2,7-bis[(Z)-[2,3-dioxo-5-(trifluoromethyl)inden-1-ylidene]methyl]-[1]benzothiolo[7,6-g][1]benzothiole-5,10-dicarboxylate |
|---|---|
| PubChem CID | 167050804 |
| Molecular Formula | C52H26F6O8S2 |
| Molecular Weight | 956.89 g/mol |
| Exact Mass | 956.10 |
| IUPAC Name | dibenzyl 2,7-bis[(Z)-[2,3-dioxo-5-(trifluoromethyl)inden-1-ylidene]methyl]-[1]benzothiolo[7,6-g][1]benzothiole-5,10-dicarboxylate |
| SMILES | O=C1C(=O)c2cc(C(F)(F)F)ccc2/C1=C/c1cc2c(C(=O)OCc3ccccc3)cc3c(cc(C(=O)OCc4ccccc4)c4cc(/C=C5\C(=O)C(=O)c6cc(C(F)(F)F)ccc65)sc43)c2s1 |
| InChI | InChI=1S/C52H26F6O8S2/c53-51(54,55)27-11-13-31-33(15-27)43(59)45(61)35(31)17-29-19-37-41(49(63)65-23-25-7-3-1-4-8-25)21-39-40(47(37)67-29)22-42(50(64)66-24-26-9-5-2-6-10-26)38-20-30(68-48(38)39)18-36-32-14-12-28(52(56,57)58)16-34(32)44(60)46(36)62/h1-22H,23-24H2/b35-17-,36-18- |
| InChIKey | KNYYJMVUWVCZNQ-VEIIUTKRSA-N |
| XLogP | 12.63 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 956.89 |
| LogP ≤ 5 | 12.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|