C48H38N2O8S2 — CID 174006646
dibenzyl 2,7-bis[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-ylidene)amino]-[1]benzothiolo[7,6-g][1]benzothiole-5,10-dicarboxylate (PubChem CID 174006646) has the molecular formula C48H38N2O8S2 and a molecular weight of 834.97 g/mol. Its IUPAC name is dibenzyl 2,7-bis[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-ylidene)amino]-[1]benzothiolo[7,6-g][1]benzothiole-5,10-dicarboxylate.
| Compound Name | dibenzyl 2,7-bis[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-ylidene)amino]-[1]benzothiolo[7,6-g][1]benzothiole-5,10-dicarboxylate |
|---|---|
| PubChem CID | 174006646 |
| Molecular Formula | C48H38N2O8S2 |
| Molecular Weight | 834.97 g/mol |
| Exact Mass | 834.21 |
| IUPAC Name | dibenzyl 2,7-bis[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-ylidene)amino]-[1]benzothiolo[7,6-g][1]benzothiole-5,10-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)c1cc2c(cc(C(=O)OCc3ccccc3)c3cc(N=C4C(=O)C5CCCCC5C4=O)sc32)c2sc(N=C3C(=O)C4CCCCC4C3=O)cc12 |
| InChI | InChI=1S/C48H38N2O8S2/c51-41-27-15-7-8-16-28(27)42(52)39(41)49-37-21-33-35(47(55)57-23-25-11-3-1-4-12-25)19-31-32(45(33)59-37)20-36(48(56)58-24-26-13-5-2-6-14-26)34-22-38(60-46(31)34)50-40-43(53)29-17-9-10-18-30(29)44(40)54/h1-6,11-14,19-22,27-30H,7-10,15-18,23-24H2 |
| InChIKey | FCAOTJGIIWYHJO-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 145.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.97 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|