C44H36N4O8S2 — CID 174005701
dibenzyl 4,11-bis[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-ylidene)amino]-3,14-dithia-7,10-diazatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-7,10-dicarboxylate (PubChem CID 174005701) has the molecular formula C44H36N4O8S2 and a molecular weight of 812.93 g/mol. Its IUPAC name is dibenzyl 4,11-bis[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-ylidene)amino]-3,14-dithia-7,10-diazatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-7,10-dicarboxylate.
| Compound Name | dibenzyl 4,11-bis[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-ylidene)amino]-3,14-dithia-7,10-diazatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-7,10-dicarboxylate |
|---|---|
| PubChem CID | 174005701 |
| Molecular Formula | C44H36N4O8S2 |
| Molecular Weight | 812.93 g/mol |
| Exact Mass | 812.20 |
| IUPAC Name | dibenzyl 4,11-bis[(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-ylidene)amino]-3,14-dithia-7,10-diazatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-7,10-dicarboxylate |
| SMILES | O=C1C(=Nc2cc3c(s2)c2sc4cc(N=C5C(=O)C6CCCCC6C5=O)n(C(=O)OCc5ccccc5)c4c2n3C(=O)OCc2ccccc2)C(=O)C2CCCCC12 |
| InChI | InChI=1S/C44H36N4O8S2/c49-37-25-15-7-8-16-26(25)38(50)33(37)45-31-20-30-35(48(31)44(54)56-22-24-13-5-2-6-14-24)36-42(57-30)41-29(47(36)43(53)55-21-23-11-3-1-4-12-23)19-32(58-41)46-34-39(51)27-17-9-10-18-28(27)40(34)52/h1-6,11-14,19-20,25-28H,7-10,15-18,21-22H2 |
| InChIKey | AFOMMESJUYHLEM-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 155.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.93 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|