C29H15N7O2S4 — CID 174006209
benzyl 4-[5-[[amino(cyano)methylidene]amino]thiophen-2-yl]-10-[5-(dicyanomethylideneamino)thiophen-2-yl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7-carboxylate (PubChem CID 174006209) has the molecular formula C29H15N7O2S4 and a molecular weight of 621.75 g/mol. Its IUPAC name is benzyl 4-[5-[[amino(cyano)methylidene]amino]thiophen-2-yl]-10-[5-(dicyanomethylideneamino)thiophen-2-yl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7-carboxylate.
| Compound Name | benzyl 4-[5-[[amino(cyano)methylidene]amino]thiophen-2-yl]-10-[5-(dicyanomethylideneamino)thiophen-2-yl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7-carboxylate |
|---|---|
| PubChem CID | 174006209 |
| Molecular Formula | C29H15N7O2S4 |
| Molecular Weight | 621.75 g/mol |
| Exact Mass | 621.02 |
| IUPAC Name | benzyl 4-[5-[[amino(cyano)methylidene]amino]thiophen-2-yl]-10-[5-(dicyanomethylideneamino)thiophen-2-yl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7-carboxylate |
| SMILES | N#CC(N)=Nc1ccc(-c2cc3c(s2)c2sc(-c4ccc(N=C(C#N)C#N)s4)cc2n3C(=O)OCc2ccccc2)s1 |
| InChI | InChI=1S/C29H15N7O2S4/c30-12-17(13-31)34-25-8-6-20(39-25)22-10-18-27(41-22)28-19(36(18)29(37)38-15-16-4-2-1-3-5-16)11-23(42-28)21-7-9-26(40-21)35-24(33)14-32/h1-11H,15H2,(H2,33,35) |
| InChIKey | YAPZILKRMZVGKO-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 153.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.75 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|