C47H32N6O6S5 — CID 167051131
dibenzyl 4,11-bis[5-(dicyanomethylideneamino)-3-propoxythiophen-2-yl]-3,7,10-trithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-14,14-dicarboxylate (PubChem CID 167051131) has the molecular formula C47H32N6O6S5 and a molecular weight of 937.14 g/mol. Its IUPAC name is dibenzyl 4,11-bis[5-(dicyanomethylideneamino)-3-propoxythiophen-2-yl]-3,7,10-trithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-14,14-dicarboxylate.
| Compound Name | dibenzyl 4,11-bis[5-(dicyanomethylideneamino)-3-propoxythiophen-2-yl]-3,7,10-trithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-14,14-dicarboxylate |
|---|---|
| PubChem CID | 167051131 |
| Molecular Formula | C47H32N6O6S5 |
| Molecular Weight | 937.14 g/mol |
| Exact Mass | 936.10 |
| IUPAC Name | dibenzyl 4,11-bis[5-(dicyanomethylideneamino)-3-propoxythiophen-2-yl]-3,7,10-trithiatetracyclo[6.6.0.02,6.09,13]tetradeca-1(8),2(6),4,9(13),11-pentaene-14,14-dicarboxylate |
| SMILES | CCCOc1cc(N=C(C#N)C#N)sc1-c1cc2c(s1)-c1sc3cc(-c4sc(N=C(C#N)C#N)cc4OCCC)sc3c1C2(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C47H32N6O6S5/c1-3-15-56-32-18-37(52-29(21-48)22-49)63-41(32)34-17-31-40(60-34)44-39(43-36(62-44)20-35(61-43)42-33(57-16-4-2)19-38(64-42)53-30(23-50)24-51)47(31,45(54)58-25-27-11-7-5-8-12-27)46(55)59-26-28-13-9-6-10-14-28/h5-14,17-20H,3-4,15-16,25-26H2,1-2H3 |
| InChIKey | GXBWCFSUQMKLTK-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 190.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 937.14 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|