C27H17F6NO5S — CID 86616620
benzyl 5-[[3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-hydroxybenzoate (PubChem CID 86616620) has the molecular formula C27H17F6NO5S and a molecular weight of 581.49 g/mol. Its IUPAC name is benzyl 5-[[3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-hydroxybenzoate.
| Compound Name | benzyl 5-[[3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 86616620 |
| Molecular Formula | C27H17F6NO5S |
| Molecular Weight | 581.49 g/mol |
| Exact Mass | 581.07 |
| IUPAC Name | benzyl 5-[[3-[[2,5-bis(trifluoromethyl)phenyl]methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-hydroxybenzoate |
| SMILES | O=C(OCc1ccccc1)c1cc(C=C2SC(=O)N(Cc3cc(C(F)(F)F)ccc3C(F)(F)F)C2=O)ccc1O |
| InChI | InChI=1S/C27H17F6NO5S/c28-26(29,30)18-7-8-20(27(31,32)33)17(12-18)13-34-23(36)22(40-25(34)38)11-16-6-9-21(35)19(10-16)24(37)39-14-15-4-2-1-3-5-15/h1-12,35H,13-14H2 |
| InChIKey | MLQOTUZXWFLFSK-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.49 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|