C18H10Br2F3NO2S — CID 51347297
(5Z)-5-[(3,5-dibromophenyl)methylidene]-3-[[2-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 51347297) has the molecular formula C18H10Br2F3NO2S and a molecular weight of 521.15 g/mol. Its IUPAC name is (5Z)-5-[(3,5-dibromophenyl)methylidene]-3-[[2-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(3,5-dibromophenyl)methylidene]-3-[[2-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 51347297 |
| Molecular Formula | C18H10Br2F3NO2S |
| Molecular Weight | 521.15 g/mol |
| Exact Mass | 518.88 |
| IUPAC Name | (5Z)-5-[(3,5-dibromophenyl)methylidene]-3-[[2-(trifluoromethyl)phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cc(Br)cc(Br)c2)C(=O)N1Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H10Br2F3NO2S/c19-12-5-10(6-13(20)8-12)7-15-16(25)24(17(26)27-15)9-11-3-1-2-4-14(11)18(21,22)23/h1-8H,9H2/b15-7- |
| InChIKey | BPEQXPXHNNOHHQ-CHHVJCJISA-N |
| XLogP | 6.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.15 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|