C32H25NO6S — CID 87839089
(4-methoxyphenyl)methyl 5-[[2,4-dioxo-3-[(4-phenylphenyl)methyl]-1,3-thiazolidin-5-ylidene]methyl]-2-hydroxybenzoate (PubChem CID 87839089) has the molecular formula C32H25NO6S and a molecular weight of 551.62 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 5-[[2,4-dioxo-3-[(4-phenylphenyl)methyl]-1,3-thiazolidin-5-ylidene]methyl]-2-hydroxybenzoate.
| Compound Name | (4-methoxyphenyl)methyl 5-[[2,4-dioxo-3-[(4-phenylphenyl)methyl]-1,3-thiazolidin-5-ylidene]methyl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 87839089 |
| Molecular Formula | C32H25NO6S |
| Molecular Weight | 551.62 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | (4-methoxyphenyl)methyl 5-[[2,4-dioxo-3-[(4-phenylphenyl)methyl]-1,3-thiazolidin-5-ylidene]methyl]-2-hydroxybenzoate |
| SMILES | COc1ccc(COC(=O)c2cc(C=C3SC(=O)N(Cc4ccc(-c5ccccc5)cc4)C3=O)ccc2O)cc1 |
| InChI | InChI=1S/C32H25NO6S/c1-38-26-14-9-22(10-15-26)20-39-31(36)27-17-23(11-16-28(27)34)18-29-30(35)33(32(37)40-29)19-21-7-12-25(13-8-21)24-5-3-2-4-6-24/h2-18,34H,19-20H2,1H3 |
| InChIKey | LGWXHGVXRXWTHR-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.62 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|