C17H13NO5S — CID 10831218
2-[(5Z)-5-[(6-methoxynaphthalen-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 10831218) has the molecular formula C17H13NO5S and a molecular weight of 343.36 g/mol. Its IUPAC name is 2-[(5Z)-5-[(6-methoxynaphthalen-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[(6-methoxynaphthalen-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 10831218 |
| Molecular Formula | C17H13NO5S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 2-[(5Z)-5-[(6-methoxynaphthalen-2-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | COc1ccc2cc(/C=C3\SC(=O)N(CC(=O)O)C3=O)ccc2c1 |
| InChI | InChI=1S/C17H13NO5S/c1-23-13-5-4-11-6-10(2-3-12(11)8-13)7-14-16(21)18(9-15(19)20)17(22)24-14/h2-8H,9H2,1H3,(H,19,20)/b14-7- |
| InChIKey | AOYYVPGUQHEOCA-AUWJEWJLSA-N |
| XLogP | 2.97 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|