C21H17NO4S — CID 53329936
2-[(5Z)-5-[[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 53329936) has the molecular formula C21H17NO4S and a molecular weight of 379.44 g/mol. Its IUPAC name is 2-[(5Z)-5-[[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 53329936 |
| Molecular Formula | C21H17NO4S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2-[(5Z)-5-[[4-[(E)-2-(4-methylphenyl)ethenyl]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | Cc1ccc(/C=C/c2ccc(/C=C3\SC(=O)N(CC(=O)O)C3=O)cc2)cc1 |
| InChI | InChI=1S/C21H17NO4S/c1-14-2-4-15(5-3-14)6-7-16-8-10-17(11-9-16)12-18-20(25)22(13-19(23)24)21(26)27-18/h2-12H,13H2,1H3,(H,23,24)/b7-6+,18-12- |
| InChIKey | ODQUCWBIUHENKK-CMPYXSCOSA-N |
| XLogP | 4.29 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|