C20H17NO2S — CID 88888187
(5Z)-5-[[4-(4-methylphenyl)phenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione (PubChem CID 88888187) has the molecular formula C20H17NO2S and a molecular weight of 335.43 g/mol. Its IUPAC name is (5Z)-5-[[4-(4-methylphenyl)phenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[4-(4-methylphenyl)phenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 88888187 |
| Molecular Formula | C20H17NO2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | (5Z)-5-[[4-(4-methylphenyl)phenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)S/C(=C\c2ccc(-c3ccc(C)cc3)cc2)C1=O |
| InChI | InChI=1S/C20H17NO2S/c1-3-12-21-19(22)18(24-20(21)23)13-15-6-10-17(11-7-15)16-8-4-14(2)5-9-16/h3-11,13H,1,12H2,2H3/b18-13- |
| InChIKey | IVRDWKBKWMDJGS-AQTBWJFISA-N |
| XLogP | 4.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|