C20H15NO4S — CID 123182239
4-[3-[(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]phenyl]benzoic acid (PubChem CID 123182239) has the molecular formula C20H15NO4S and a molecular weight of 365.41 g/mol. Its IUPAC name is 4-[3-[(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]phenyl]benzoic acid.
| Compound Name | 4-[3-[(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 123182239 |
| Molecular Formula | C20H15NO4S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 4-[3-[(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]phenyl]benzoic acid |
| SMILES | C=CCN1C(=O)SC(=Cc2cccc(-c3ccc(C(=O)O)cc3)c2)C1=O |
| InChI | InChI=1S/C20H15NO4S/c1-2-10-21-18(22)17(26-20(21)25)12-13-4-3-5-16(11-13)14-6-8-15(9-7-14)19(23)24/h2-9,11-12H,1,10H2,(H,23,24) |
| InChIKey | CPPMZJICCGZOSI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|