C18H13NO4S2 — CID 87410026
3-[5-[(Z)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]thiophen-3-yl]benzoic acid (PubChem CID 87410026) has the molecular formula C18H13NO4S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-[5-[(Z)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]thiophen-3-yl]benzoic acid.
| Compound Name | 3-[5-[(Z)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]thiophen-3-yl]benzoic acid |
|---|---|
| PubChem CID | 87410026 |
| Molecular Formula | C18H13NO4S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 3-[5-[(Z)-(2,4-dioxo-3-prop-2-enyl-1,3-thiazolidin-5-ylidene)methyl]thiophen-3-yl]benzoic acid |
| SMILES | C=CCN1C(=O)S/C(=C\c2cc(-c3cccc(C(=O)O)c3)cs2)C1=O |
| InChI | InChI=1S/C18H13NO4S2/c1-2-6-19-16(20)15(25-18(19)23)9-14-8-13(10-24-14)11-4-3-5-12(7-11)17(21)22/h2-5,7-10H,1,6H2,(H,21,22)/b15-9- |
| InChIKey | UDZSOTMGGMMMRK-DHDCSXOGSA-N |
| XLogP | 4.34 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_G(7)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|