C21H14ClNO2S2 — CID 88888245
(5Z)-3-benzyl-5-[[4-(4-chlorophenyl)thiophen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 88888245) has the molecular formula C21H14ClNO2S2 and a molecular weight of 411.94 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-[[4-(4-chlorophenyl)thiophen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-benzyl-5-[[4-(4-chlorophenyl)thiophen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 88888245 |
| Molecular Formula | C21H14ClNO2S2 |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.02 |
| IUPAC Name | (5Z)-3-benzyl-5-[[4-(4-chlorophenyl)thiophen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C\c2cc(-c3ccc(Cl)cc3)cs2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H14ClNO2S2/c22-17-8-6-15(7-9-17)16-10-18(26-13-16)11-19-20(24)23(21(25)27-19)12-14-4-2-1-3-5-14/h1-11,13H,12H2/b19-11- |
| InChIKey | MSENWTBGEXQZIN-ODLFYWEKSA-N |
| XLogP | 6.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|