C22H15NO4S2 — CID 123677295
4-[5-[(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]benzoic acid (PubChem CID 123677295) has the molecular formula C22H15NO4S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-[5-[(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]benzoic acid.
| Compound Name | 4-[5-[(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 123677295 |
| Molecular Formula | C22H15NO4S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 4-[5-[(3-benzyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]thiophen-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(C=C3SC(=O)N(Cc4ccccc4)C3=O)s2)cc1 |
| InChI | InChI=1S/C22H15NO4S2/c24-20-19(29-22(27)23(20)13-14-4-2-1-3-5-14)12-17-10-11-18(28-17)15-6-8-16(9-7-15)21(25)26/h1-12H,13H2,(H,25,26) |
| InChIKey | IXJZWAUXQPKLPX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|