C12H10N2O5S — CID 135357282
2-[(5Z)-5-[(6-methoxy-3-pyridinyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 135357282) has the molecular formula C12H10N2O5S and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-[(5Z)-5-[(6-methoxy-3-pyridinyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[(6-methoxy-3-pyridinyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 135357282 |
| Molecular Formula | C12H10N2O5S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2-[(5Z)-5-[(6-methoxy-3-pyridinyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | COc1ccc(/C=C2\SC(=O)N(CC(=O)O)C2=O)cn1 |
| InChI | InChI=1S/C12H10N2O5S/c1-19-9-3-2-7(5-13-9)4-8-11(17)14(6-10(15)16)12(18)20-8/h2-5H,6H2,1H3,(H,15,16)/b8-4- |
| InChIKey | RMODJPCUFMEPFI-YWEYNIOJSA-N |
| XLogP | 1.21 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|