C43H24N2O8S2 — CID 167050861
dibenzyl 4,10-bis[(Z)-(2,3-dioxoinden-1-ylidene)methyl]-3,11-dithia-5,9-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,7-dicarboxylate (PubChem CID 167050861) has the molecular formula C43H24N2O8S2 and a molecular weight of 760.81 g/mol. Its IUPAC name is dibenzyl 4,10-bis[(Z)-(2,3-dioxoinden-1-ylidene)methyl]-3,11-dithia-5,9-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,7-dicarboxylate.
| Compound Name | dibenzyl 4,10-bis[(Z)-(2,3-dioxoinden-1-ylidene)methyl]-3,11-dithia-5,9-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,7-dicarboxylate |
|---|---|
| PubChem CID | 167050861 |
| Molecular Formula | C43H24N2O8S2 |
| Molecular Weight | 760.81 g/mol |
| Exact Mass | 760.10 |
| IUPAC Name | dibenzyl 4,10-bis[(Z)-(2,3-dioxoinden-1-ylidene)methyl]-3,11-dithia-5,9-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,7-dicarboxylate |
| SMILES | O=C1C(=O)c2ccccc2/C1=C/c1nc2c(s1)-c1sc(/C=C3\C(=O)C(=O)c4ccccc43)nc1C2(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C43H24N2O8S2/c46-33-27-17-9-7-15-25(27)29(35(33)48)19-31-44-39-37(54-31)38-40(45-32(55-38)20-30-26-16-8-10-18-28(26)34(47)36(30)49)43(39,41(50)52-21-23-11-3-1-4-12-23)42(51)53-22-24-13-5-2-6-14-24/h1-20H,21-22H2/b29-19-,30-20- |
| InChIKey | VLLGRRYIVVOKSR-NAZWXXJZSA-N |
| XLogP | 6.96 |
| TPSA | 146.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.81 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|