C47H22N8O6S2 — CID 174005315
dibenzyl 4,10-bis[[1-(dicyanomethylidene)-3-oxoinden-2-ylidene]amino]-3,11-dithia-5,9-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,7-dicarboxylate (PubChem CID 174005315) has the molecular formula C47H22N8O6S2 and a molecular weight of 858.88 g/mol. Its IUPAC name is dibenzyl 4,10-bis[[1-(dicyanomethylidene)-3-oxoinden-2-ylidene]amino]-3,11-dithia-5,9-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,7-dicarboxylate.
| Compound Name | dibenzyl 4,10-bis[[1-(dicyanomethylidene)-3-oxoinden-2-ylidene]amino]-3,11-dithia-5,9-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,7-dicarboxylate |
|---|---|
| PubChem CID | 174005315 |
| Molecular Formula | C47H22N8O6S2 |
| Molecular Weight | 858.88 g/mol |
| Exact Mass | 858.11 |
| IUPAC Name | dibenzyl 4,10-bis[[1-(dicyanomethylidene)-3-oxoinden-2-ylidene]amino]-3,11-dithia-5,9-diazatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene-7,7-dicarboxylate |
| SMILES | N#CC(C#N)=C1C(=Nc2nc3c(s2)-c2sc(N=C4C(=O)c5ccccc5C4=C(C#N)C#N)nc2C3(C(=O)OCc2ccccc2)C(=O)OCc2ccccc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C47H22N8O6S2/c48-19-27(20-49)33-29-15-7-9-17-31(29)37(56)35(33)52-45-54-41-39(62-45)40-42(55-46(63-40)53-36-34(28(21-50)22-51)30-16-8-10-18-32(30)38(36)57)47(41,43(58)60-23-25-11-3-1-4-12-25)44(59)61-24-26-13-5-2-6-14-26/h1-18H,23-24H2 |
| InChIKey | HCQDWBREFHXHMP-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 232.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.88 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|