C39H22O4S2 — CID 164977330
2-[[16-[(1,3-dioxoinden-2-ylidene)methyl]-11,11-dimethyl-5,17-dithiapentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,6,8,13,15,18-octaen-6-yl]methylidene]indene-1,3-dione (PubChem CID 164977330) has the molecular formula C39H22O4S2 and a molecular weight of 618.74 g/mol. Its IUPAC name is 2-[[16-[(1,3-dioxoinden-2-ylidene)methyl]-11,11-dimethyl-5,17-dithiapentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,6,8,13,15,18-octaen-6-yl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[16-[(1,3-dioxoinden-2-ylidene)methyl]-11,11-dimethyl-5,17-dithiapentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,6,8,13,15,18-octaen-6-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 164977330 |
| Molecular Formula | C39H22O4S2 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.10 |
| IUPAC Name | 2-[[16-[(1,3-dioxoinden-2-ylidene)methyl]-11,11-dimethyl-5,17-dithiapentacyclo[10.7.0.02,10.04,8.014,18]nonadeca-1(12),2(10),3,6,8,13,15,18-octaen-6-yl]methylidene]indene-1,3-dione |
| SMILES | CC1(C)c2cc3cc(C=C4C(=O)c5ccccc5C4=O)sc3cc2-c2cc3sc(C=C4C(=O)c5ccccc5C4=O)cc3cc21 |
| InChI | InChI=1S/C39H22O4S2/c1-39(2)31-13-19-11-21(15-29-35(40)23-7-3-4-8-24(23)36(29)41)44-33(19)17-27(31)28-18-34-20(14-32(28)39)12-22(45-34)16-30-37(42)25-9-5-6-10-26(25)38(30)43/h3-18H,1-2H3 |
| InChIKey | KCVAHFFOYHKKNC-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|