C41H33NO2S — CID 166677713
2-[(5,5,15,15,21,21-hexamethyl-25-thia-1-azaheptacyclo[14.10.1.02,14.04,12.06,11.020,27.022,26]heptacosa-2(14),3,6,8,10,12,16,18,20(27),22(26),23-undecaen-24-yl)methylidene]indene-1,3-dione (PubChem CID 166677713) has the molecular formula C41H33NO2S and a molecular weight of 603.79 g/mol. Its IUPAC name is 2-[(5,5,15,15,21,21-hexamethyl-25-thia-1-azaheptacyclo[14.10.1.02,14.04,12.06,11.020,27.022,26]heptacosa-2(14),3,6,8,10,12,16,18,20(27),22(26),23-undecaen-24-yl)methylidene]indene-1,3-dione.
| Compound Name | 2-[(5,5,15,15,21,21-hexamethyl-25-thia-1-azaheptacyclo[14.10.1.02,14.04,12.06,11.020,27.022,26]heptacosa-2(14),3,6,8,10,12,16,18,20(27),22(26),23-undecaen-24-yl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 166677713 |
| Molecular Formula | C41H33NO2S |
| Molecular Weight | 603.79 g/mol |
| Exact Mass | 603.22 |
| IUPAC Name | 2-[(5,5,15,15,21,21-hexamethyl-25-thia-1-azaheptacyclo[14.10.1.02,14.04,12.06,11.020,27.022,26]heptacosa-2(14),3,6,8,10,12,16,18,20(27),22(26),23-undecaen-24-yl)methylidene]indene-1,3-dione |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)N1c2sc(C=C4C(=O)c5ccccc5C4=O)cc2C(C)(C)c2cccc(c21)C3(C)C |
| InChI | InChI=1S/C41H33NO2S/c1-39(2)28-15-10-9-12-23(28)26-20-32-34(21-31(26)39)42-35-29(40(32,3)4)16-11-17-30(35)41(5,6)33-19-22(45-38(33)42)18-27-36(43)24-13-7-8-14-25(24)37(27)44/h7-21H,1-6H3 |
| InChIKey | VHDCIJHBAIWJJV-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.79 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|