C31H24N2S3 — CID 172506343
2-[(7,7,13,13-tetramethyl-3-thia-1,18-diazapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14(19),15,17-octaen-4-yl)methylidene]indene-1,3-dithione (PubChem CID 172506343) has the molecular formula C31H24N2S3 and a molecular weight of 520.75 g/mol. Its IUPAC name is 2-[(7,7,13,13-tetramethyl-3-thia-1,18-diazapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14(19),15,17-octaen-4-yl)methylidene]indene-1,3-dithione.
| Compound Name | 2-[(7,7,13,13-tetramethyl-3-thia-1,18-diazapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14(19),15,17-octaen-4-yl)methylidene]indene-1,3-dithione |
|---|---|
| PubChem CID | 172506343 |
| Molecular Formula | C31H24N2S3 |
| Molecular Weight | 520.75 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 2-[(7,7,13,13-tetramethyl-3-thia-1,18-diazapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14(19),15,17-octaen-4-yl)methylidene]indene-1,3-dithione |
| SMILES | CC1(C)c2cccnc2N2c3sc(C=C4C(=S)c5ccccc5C4=S)cc3C(C)(C)c3cccc1c32 |
| InChI | InChI=1S/C31H24N2S3/c1-30(2)21-11-7-12-22-25(21)33(28-23(30)13-8-14-32-28)29-24(31(22,3)4)16-17(36-29)15-20-26(34)18-9-5-6-10-19(18)27(20)35/h5-16H,1-4H3 |
| InChIKey | PBKWXJSWRSGFRP-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.75 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|