C34H22F3NOS3 — CID 172506253
(6Z)-6-[[7,13,13-trimethyl-7-(trifluoromethyl)-3-thia-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14,16,18-octaen-4-yl]methylidene]cyclopenta[f][1]benzofuran-5,7-dithione (PubChem CID 172506253) has the molecular formula C34H22F3NOS3 and a molecular weight of 613.75 g/mol. Its IUPAC name is (6Z)-6-[[7,13,13-trimethyl-7-(trifluoromethyl)-3-thia-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14,16,18-octaen-4-yl]methylidene]cyclopenta[f][1]benzofuran-5,7-dithione.
| Compound Name | (6Z)-6-[[7,13,13-trimethyl-7-(trifluoromethyl)-3-thia-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14,16,18-octaen-4-yl]methylidene]cyclopenta[f][1]benzofuran-5,7-dithione |
|---|---|
| PubChem CID | 172506253 |
| Molecular Formula | C34H22F3NOS3 |
| Molecular Weight | 613.75 g/mol |
| Exact Mass | 613.08 |
| IUPAC Name | (6Z)-6-[[7,13,13-trimethyl-7-(trifluoromethyl)-3-thia-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14,16,18-octaen-4-yl]methylidene]cyclopenta[f][1]benzofuran-5,7-dithione |
| SMILES | CC1(C)c2ccccc2N2c3sc(/C=C4/C(=S)c5cc6ccoc6cc5C4=S)cc3C(C)(C(F)(F)F)c3cccc1c32 |
| InChI | InChI=1S/C34H22F3NOS3/c1-32(2)22-7-4-5-10-26(22)38-28-23(32)8-6-9-24(28)33(3,34(35,36)37)25-15-18(42-31(25)38)14-21-29(40)19-13-17-11-12-39-27(17)16-20(19)30(21)41/h4-16H,1-3H3/b21-14- |
| InChIKey | JVVJGPRJUFWFIC-STZFKDTASA-N |
| XLogP | 10.32 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.75 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|