C29H24F3N3O3S — CID 172506368
5-[[7,10,13,13,16-pentamethyl-7-(trifluoromethyl)-3-thia-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14(19),15,17-octaen-4-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 172506368) has the molecular formula C29H24F3N3O3S and a molecular weight of 551.59 g/mol. Its IUPAC name is 5-[[7,10,13,13,16-pentamethyl-7-(trifluoromethyl)-3-thia-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14(19),15,17-octaen-4-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[7,10,13,13,16-pentamethyl-7-(trifluoromethyl)-3-thia-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14(19),15,17-octaen-4-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 172506368 |
| Molecular Formula | C29H24F3N3O3S |
| Molecular Weight | 551.59 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 5-[[7,10,13,13,16-pentamethyl-7-(trifluoromethyl)-3-thia-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14(19),15,17-octaen-4-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(C)cc3c1N2c1sc(C=C2C(=O)NC(=O)NC2=O)cc1C3(C)C(F)(F)F |
| InChI | InChI=1S/C29H24F3N3O3S/c1-13-6-7-21-17(8-13)27(3,4)18-9-14(2)10-19-22(18)35(21)25-20(28(19,5)29(30,31)32)12-15(39-25)11-16-23(36)33-26(38)34-24(16)37/h6-12H,1-5H3,(H2,33,34,36,37,38) |
| InChIKey | AVKDPEYZVLVOIX-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.59 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|