C35H29F2NO2 — CID 171405662
2-[[2,5-dimethyl-4-(2,7,9,9-tetramethylacridin-10-yl)phenyl]methylidene]-5,6-difluoroindene-1,3-dione (PubChem CID 171405662) has the molecular formula C35H29F2NO2 and a molecular weight of 533.62 g/mol. Its IUPAC name is 2-[[2,5-dimethyl-4-(2,7,9,9-tetramethylacridin-10-yl)phenyl]methylidene]-5,6-difluoroindene-1,3-dione.
| Compound Name | 2-[[2,5-dimethyl-4-(2,7,9,9-tetramethylacridin-10-yl)phenyl]methylidene]-5,6-difluoroindene-1,3-dione |
|---|---|
| PubChem CID | 171405662 |
| Molecular Formula | C35H29F2NO2 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 2-[[2,5-dimethyl-4-(2,7,9,9-tetramethylacridin-10-yl)phenyl]methylidene]-5,6-difluoroindene-1,3-dione |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(C)ccc1N2c1cc(C)c(C=C2C(=O)c3cc(F)c(F)cc3C2=O)cc1C |
| InChI | InChI=1S/C35H29F2NO2/c1-18-7-9-30-26(11-18)35(5,6)27-12-19(2)8-10-31(27)38(30)32-14-20(3)22(13-21(32)4)15-25-33(39)23-16-28(36)29(37)17-24(23)34(25)40/h7-17H,1-6H3 |
| InChIKey | YOWFJHMPKGNUOX-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|