C33H25F2NO2 — CID 171405654
2-[[4-(9,9-dimethylacridin-10-yl)-2,5-dimethylphenyl]methylidene]-5,6-difluoroindene-1,3-dione (PubChem CID 171405654) has the molecular formula C33H25F2NO2 and a molecular weight of 505.56 g/mol. Its IUPAC name is 2-[[4-(9,9-dimethylacridin-10-yl)-2,5-dimethylphenyl]methylidene]-5,6-difluoroindene-1,3-dione.
| Compound Name | 2-[[4-(9,9-dimethylacridin-10-yl)-2,5-dimethylphenyl]methylidene]-5,6-difluoroindene-1,3-dione |
|---|---|
| PubChem CID | 171405654 |
| Molecular Formula | C33H25F2NO2 |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 2-[[4-(9,9-dimethylacridin-10-yl)-2,5-dimethylphenyl]methylidene]-5,6-difluoroindene-1,3-dione |
| SMILES | Cc1cc(N2c3ccccc3C(C)(C)c3ccccc32)c(C)cc1C=C1C(=O)c2cc(F)c(F)cc2C1=O |
| InChI | InChI=1S/C33H25F2NO2/c1-18-14-30(36-28-11-7-5-9-24(28)33(3,4)25-10-6-8-12-29(25)36)19(2)13-20(18)15-23-31(37)21-16-26(34)27(35)17-22(21)32(23)38/h5-17H,1-4H3 |
| InChIKey | OILMPRYGLOCMRN-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|