C27H19NO2Se2 — CID 140821941
5-[[5-(9,9-dimethylacridin-10-yl)selenophen-2-yl]methylidene]cyclopenta[c]selenophene-4,6-dione (PubChem CID 140821941) has the molecular formula C27H19NO2Se2 and a molecular weight of 547.37 g/mol. Its IUPAC name is 5-[[5-(9,9-dimethylacridin-10-yl)selenophen-2-yl]methylidene]cyclopenta[c]selenophene-4,6-dione.
| Compound Name | 5-[[5-(9,9-dimethylacridin-10-yl)selenophen-2-yl]methylidene]cyclopenta[c]selenophene-4,6-dione |
|---|---|
| PubChem CID | 140821941 |
| Molecular Formula | C27H19NO2Se2 |
| Molecular Weight | 547.37 g/mol |
| Exact Mass | 548.97 |
| IUPAC Name | 5-[[5-(9,9-dimethylacridin-10-yl)selenophen-2-yl]methylidene]cyclopenta[c]selenophene-4,6-dione |
| SMILES | CC1(C)c2ccccc2N(c2ccc(C=C3C(=O)c4c[se]cc4C3=O)[se]2)c2ccccc21 |
| InChI | InChI=1S/C27H19NO2Se2/c1-27(2)20-7-3-5-9-22(20)28(23-10-6-4-8-21(23)27)24-12-11-16(32-24)13-17-25(29)18-14-31-15-19(18)26(17)30/h3-15H,1-2H3 |
| InChIKey | XCUVLYSTAQCLIN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.37 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|