C28H15NO2S2Se — CID 140822012
6-[(5-phenothiazin-10-ylselenophen-2-yl)methylidene]cyclopenta[f][2]benzothiole-5,7-dione (PubChem CID 140822012) has the molecular formula C28H15NO2S2Se and a molecular weight of 540.53 g/mol. Its IUPAC name is 6-[(5-phenothiazin-10-ylselenophen-2-yl)methylidene]cyclopenta[f][2]benzothiole-5,7-dione.
| Compound Name | 6-[(5-phenothiazin-10-ylselenophen-2-yl)methylidene]cyclopenta[f][2]benzothiole-5,7-dione |
|---|---|
| PubChem CID | 140822012 |
| Molecular Formula | C28H15NO2S2Se |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.97 |
| IUPAC Name | 6-[(5-phenothiazin-10-ylselenophen-2-yl)methylidene]cyclopenta[f][2]benzothiole-5,7-dione |
| SMILES | O=C1C(=Cc2ccc(N3c4ccccc4Sc4ccccc43)[se]2)C(=O)c2cc3cscc3cc21 |
| InChI | InChI=1S/C28H15NO2S2Se/c30-27-19-11-16-14-32-15-17(16)12-20(19)28(31)21(27)13-18-9-10-26(34-18)29-22-5-1-3-7-24(22)33-25-8-4-2-6-23(25)29/h1-15H |
| InChIKey | NHTHWXDGMXNKCC-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|