C32H17NO2S3 — CID 166682805
(2E)-2-[(5-phenothiazin-10-ylthiophen-2-yl)methylidene]indeno[5,6-b][1]benzothiole-1,3-dione (PubChem CID 166682805) has the molecular formula C32H17NO2S3 and a molecular weight of 543.69 g/mol. Its IUPAC name is (2E)-2-[(5-phenothiazin-10-ylthiophen-2-yl)methylidene]indeno[5,6-b][1]benzothiole-1,3-dione.
| Compound Name | (2E)-2-[(5-phenothiazin-10-ylthiophen-2-yl)methylidene]indeno[5,6-b][1]benzothiole-1,3-dione |
|---|---|
| PubChem CID | 166682805 |
| Molecular Formula | C32H17NO2S3 |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.04 |
| IUPAC Name | (2E)-2-[(5-phenothiazin-10-ylthiophen-2-yl)methylidene]indeno[5,6-b][1]benzothiole-1,3-dione |
| SMILES | O=C1/C(=C/c2ccc(N3c4ccccc4Sc4ccccc43)s2)C(=O)c2cc3c(cc21)sc1ccccc13 |
| InChI | InChI=1S/C32H17NO2S3/c34-31-21-16-20-19-7-1-4-10-26(19)37-29(20)17-22(21)32(35)23(31)15-18-13-14-30(36-18)33-24-8-2-5-11-27(24)38-28-12-6-3-9-25(28)33/h1-17H/b23-15+ |
| InChIKey | WZLNVCQHPKPIAQ-HZHRSRAPSA-N |
| XLogP | 9.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|