C30H19NO2S2 — CID 138700702
(2E)-1-hydroxy-2-[(5-phenothiazin-10-ylthiophen-2-yl)methylidene]-1H-cyclopenta[b]naphthalen-3-one (PubChem CID 138700702) has the molecular formula C30H19NO2S2 and a molecular weight of 489.62 g/mol. Its IUPAC name is (2E)-1-hydroxy-2-[(5-phenothiazin-10-ylthiophen-2-yl)methylidene]-1H-cyclopenta[b]naphthalen-3-one.
| Compound Name | (2E)-1-hydroxy-2-[(5-phenothiazin-10-ylthiophen-2-yl)methylidene]-1H-cyclopenta[b]naphthalen-3-one |
|---|---|
| PubChem CID | 138700702 |
| Molecular Formula | C30H19NO2S2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | (2E)-1-hydroxy-2-[(5-phenothiazin-10-ylthiophen-2-yl)methylidene]-1H-cyclopenta[b]naphthalen-3-one |
| SMILES | O=C1/C(=C/c2ccc(N3c4ccccc4Sc4ccccc43)s2)C(O)c2cc3ccccc3cc21 |
| InChI | InChI=1S/C30H19NO2S2/c32-29-21-15-18-7-1-2-8-19(18)16-22(21)30(33)23(29)17-20-13-14-28(34-20)31-24-9-3-5-11-26(24)35-27-12-6-4-10-25(27)31/h1-17,29,32H/b23-17+ |
| InChIKey | AXQGOEPMJGYKCG-HAVVHWLPSA-N |
| XLogP | 8.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|