C29H19NO2SeTe — CID 160708281
2-[(7,7-dimethyl-3-selena-13-tellura-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8(20),9,11,14,16,18-octaen-4-yl)methylidene]indene-1,3-dione (PubChem CID 160708281) has the molecular formula C29H19NO2SeTe and a molecular weight of 620.04 g/mol. Its IUPAC name is 2-[(7,7-dimethyl-3-selena-13-tellura-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8(20),9,11,14,16,18-octaen-4-yl)methylidene]indene-1,3-dione.
| Compound Name | 2-[(7,7-dimethyl-3-selena-13-tellura-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8(20),9,11,14,16,18-octaen-4-yl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 160708281 |
| Molecular Formula | C29H19NO2SeTe |
| Molecular Weight | 620.04 g/mol |
| Exact Mass | 622.96 |
| IUPAC Name | 2-[(7,7-dimethyl-3-selena-13-tellura-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8(20),9,11,14,16,18-octaen-4-yl)methylidene]indene-1,3-dione |
| SMILES | CC1(C)c2cc(C=C3C(=O)c4ccccc4C3=O)[se]c2N2c3ccccc3[Te]c3cccc1c32 |
| InChI | InChI=1S/C29H19NO2SeTe/c1-29(2)20-10-7-13-24-25(20)30(22-11-5-6-12-23(22)34-24)28-21(29)15-16(33-28)14-19-26(31)17-8-3-4-9-18(17)27(19)32/h3-15H,1-2H3 |
| InChIKey | KBJXADGPUNPSCE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.04 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|