C25H27N3O3Se — CID 168801088
1,3-dimethyl-5-[(6,6,15,15-tetramethyl-11-selena-9-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),10(14),12-pentaen-12-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 168801088) has the molecular formula C25H27N3O3Se and a molecular weight of 496.47 g/mol. Its IUPAC name is 1,3-dimethyl-5-[(6,6,15,15-tetramethyl-11-selena-9-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),10(14),12-pentaen-12-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-[(6,6,15,15-tetramethyl-11-selena-9-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),10(14),12-pentaen-12-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 168801088 |
| Molecular Formula | C25H27N3O3Se |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 1,3-dimethyl-5-[(6,6,15,15-tetramethyl-11-selena-9-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),10(14),12-pentaen-12-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(=Cc2cc3c([se]2)N2CCC(C)(C)c4cccc(c42)C3(C)C)C(=O)N(C)C1=O |
| InChI | InChI=1S/C25H27N3O3Se/c1-24(2)10-11-28-19-16(24)8-7-9-17(19)25(3,4)18-13-14(32-22(18)28)12-15-20(29)26(5)23(31)27(6)21(15)30/h7-9,12-13H,10-11H2,1-6H3 |
| InChIKey | BETLZIOLLWGUDY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|