C26H21N3O4Se — CID 164816588
5-[(13,13-dimethyl-7-oxa-3-selena-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14,16,18-octaen-4-yl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 164816588) has the molecular formula C26H21N3O4Se and a molecular weight of 518.43 g/mol. Its IUPAC name is 5-[(13,13-dimethyl-7-oxa-3-selena-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14,16,18-octaen-4-yl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(13,13-dimethyl-7-oxa-3-selena-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14,16,18-octaen-4-yl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 164816588 |
| Molecular Formula | C26H21N3O4Se |
| Molecular Weight | 518.43 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | 5-[(13,13-dimethyl-7-oxa-3-selena-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14,16,18-octaen-4-yl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(=Cc2cc3c([se]2)N2c4ccccc4C(C)(C)c4cccc(c42)O3)C(=O)N(C)C1=O |
| InChI | InChI=1S/C26H21N3O4Se/c1-26(2)16-8-5-6-10-18(16)29-21-17(26)9-7-11-19(21)33-20-13-14(34-24(20)29)12-15-22(30)27(3)25(32)28(4)23(15)31/h5-13H,1-4H3 |
| InChIKey | AOWQJVKRIYJMBZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.43 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|