C28H25N3O2S2 — CID 167162994
(5E)-1-methyl-2-sulfanylidene-5-[(7,7,13,13-tetramethyl-3-thia-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14,16,18-octaen-4-yl)methylidene]-1,3-diazinane-4,6-dione (PubChem CID 167162994) has the molecular formula C28H25N3O2S2 and a molecular weight of 499.66 g/mol. Its IUPAC name is (5E)-1-methyl-2-sulfanylidene-5-[(7,7,13,13-tetramethyl-3-thia-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14,16,18-octaen-4-yl)methylidene]-1,3-diazinane-4,6-dione.
| Compound Name | (5E)-1-methyl-2-sulfanylidene-5-[(7,7,13,13-tetramethyl-3-thia-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14,16,18-octaen-4-yl)methylidene]-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 167162994 |
| Molecular Formula | C28H25N3O2S2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | (5E)-1-methyl-2-sulfanylidene-5-[(7,7,13,13-tetramethyl-3-thia-1-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8,10,12(20),14,16,18-octaen-4-yl)methylidene]-1,3-diazinane-4,6-dione |
| SMILES | CN1C(=O)/C(=C/c2cc3c(s2)N2c4ccccc4C(C)(C)c4cccc(c42)C3(C)C)C(=O)NC1=S |
| InChI | InChI=1S/C28H25N3O2S2/c1-27(2)17-9-6-7-12-21(17)31-22-18(27)10-8-11-19(22)28(3,4)20-14-15(35-25(20)31)13-16-23(32)29-26(34)30(5)24(16)33/h6-14H,1-5H3,(H,29,32,34)/b16-13+ |
| InChIKey | ONSQUGTUNHLRKI-DTQAZKPQSA-N |
| XLogP | 5.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|