C30H31N3O3SSi — CID 172506366
5-[(7,7,10,13,13,16-hexamethyl-3-thia-1-aza-13-silapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8(20),9,11,14(19),15,17-octaen-4-yl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 172506366) has the molecular formula C30H31N3O3SSi and a molecular weight of 541.75 g/mol. Its IUPAC name is 5-[(7,7,10,13,13,16-hexamethyl-3-thia-1-aza-13-silapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8(20),9,11,14(19),15,17-octaen-4-yl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(7,7,10,13,13,16-hexamethyl-3-thia-1-aza-13-silapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8(20),9,11,14(19),15,17-octaen-4-yl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 172506366 |
| Molecular Formula | C30H31N3O3SSi |
| Molecular Weight | 541.75 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 5-[(7,7,10,13,13,16-hexamethyl-3-thia-1-aza-13-silapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8(20),9,11,14(19),15,17-octaen-4-yl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc2c(c1)[Si](C)(C)c1cc(C)cc3c1N2c1sc(C=C2C(=O)N(C)C(=O)N(C)C2=O)cc1C3(C)C |
| InChI | InChI=1S/C30H31N3O3SSi/c1-16-9-10-22-23(12-16)38(7,8)24-13-17(2)11-20-25(24)33(22)28-21(30(20,3)4)15-18(37-28)14-19-26(34)31(5)29(36)32(6)27(19)35/h9-15H,1-8H3 |
| InChIKey | DFBHTCLANZMEBZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.75 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|