C28H27N3O2SSeSi — CID 172506301
1,3-dimethyl-2-selanylidene-5-[(7,7,13,13-tetramethyl-3-thia-1-aza-13-silapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8(20),9,11,14,16,18-octaen-4-yl)methylidene]-1,3-diazinane-4,6-dione (PubChem CID 172506301) has the molecular formula C28H27N3O2SSeSi and a molecular weight of 576.66 g/mol. Its IUPAC name is 1,3-dimethyl-2-selanylidene-5-[(7,7,13,13-tetramethyl-3-thia-1-aza-13-silapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8(20),9,11,14,16,18-octaen-4-yl)methylidene]-1,3-diazinane-4,6-dione.
| Compound Name | 1,3-dimethyl-2-selanylidene-5-[(7,7,13,13-tetramethyl-3-thia-1-aza-13-silapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8(20),9,11,14,16,18-octaen-4-yl)methylidene]-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 172506301 |
| Molecular Formula | C28H27N3O2SSeSi |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 577.08 |
| IUPAC Name | 1,3-dimethyl-2-selanylidene-5-[(7,7,13,13-tetramethyl-3-thia-1-aza-13-silapentacyclo[10.7.1.02,6.08,20.014,19]icosa-2(6),4,8(20),9,11,14,16,18-octaen-4-yl)methylidene]-1,3-diazinane-4,6-dione |
| SMILES | CN1C(=O)C(=Cc2cc3c(s2)N2c4ccccc4[Si](C)(C)c4cccc(c42)C3(C)C)C(=O)N(C)C1=[Se] |
| InChI | InChI=1S/C28H27N3O2SSeSi/c1-28(2)18-10-9-13-22-23(18)31(20-11-7-8-12-21(20)36(22,5)6)26-19(28)15-16(34-26)14-17-24(32)29(3)27(35)30(4)25(17)33/h7-15H,1-6H3 |
| InChIKey | LMRHWKPFGCPQHI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|