C30H20N2O2S — CID 166678157
2-[(7,7-dimethyl-3-thia-1,14-diazapentacyclo[10.8.1.02,6.08,21.015,20]henicosa-2(6),4,8,10,12(21),13,15,17,19-nonaen-4-yl)methylidene]indene-1,3-dione (PubChem CID 166678157) has the molecular formula C30H20N2O2S and a molecular weight of 472.57 g/mol. Its IUPAC name is 2-[(7,7-dimethyl-3-thia-1,14-diazapentacyclo[10.8.1.02,6.08,21.015,20]henicosa-2(6),4,8,10,12(21),13,15,17,19-nonaen-4-yl)methylidene]indene-1,3-dione.
| Compound Name | 2-[(7,7-dimethyl-3-thia-1,14-diazapentacyclo[10.8.1.02,6.08,21.015,20]henicosa-2(6),4,8,10,12(21),13,15,17,19-nonaen-4-yl)methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 166678157 |
| Molecular Formula | C30H20N2O2S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 2-[(7,7-dimethyl-3-thia-1,14-diazapentacyclo[10.8.1.02,6.08,21.015,20]henicosa-2(6),4,8,10,12(21),13,15,17,19-nonaen-4-yl)methylidene]indene-1,3-dione |
| SMILES | CC1(C)c2cc(C=C3C(=O)c4ccccc4C3=O)sc2N2c3ccccc3N=Cc3cccc1c32 |
| InChI | InChI=1S/C30H20N2O2S/c1-30(2)22-11-7-8-17-16-31-24-12-5-6-13-25(24)32(26(17)22)29-23(30)15-18(35-29)14-21-27(33)19-9-3-4-10-20(19)28(21)34/h3-16H,1-2H3 |
| InChIKey | NKLTXULIOILANZ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|