C43H29F2NO2S — CID 159283355
4,7-difluoro-2-[[6'-methyl-9'-(2,4,6-trimethylphenyl)spiro[fluorene-9,4'-thieno[2,3-b]quinoline]-2'-yl]methylidene]indene-1,3-dione (PubChem CID 159283355) has the molecular formula C43H29F2NO2S and a molecular weight of 661.77 g/mol. Its IUPAC name is 4,7-difluoro-2-[[6'-methyl-9'-(2,4,6-trimethylphenyl)spiro[fluorene-9,4'-thieno[2,3-b]quinoline]-2'-yl]methylidene]indene-1,3-dione.
| Compound Name | 4,7-difluoro-2-[[6'-methyl-9'-(2,4,6-trimethylphenyl)spiro[fluorene-9,4'-thieno[2,3-b]quinoline]-2'-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 159283355 |
| Molecular Formula | C43H29F2NO2S |
| Molecular Weight | 661.77 g/mol |
| Exact Mass | 661.19 |
| IUPAC Name | 4,7-difluoro-2-[[6'-methyl-9'-(2,4,6-trimethylphenyl)spiro[fluorene-9,4'-thieno[2,3-b]quinoline]-2'-yl]methylidene]indene-1,3-dione |
| SMILES | Cc1cc(C)c(N2c3ccc(C)cc3C3(c4ccccc4-c4ccccc43)c3cc(C=C4C(=O)c5c(F)ccc(F)c5C4=O)sc32)c(C)c1 |
| InChI | InChI=1S/C43H29F2NO2S/c1-22-13-16-36-32(19-22)43(30-11-7-5-9-27(30)28-10-6-8-12-31(28)43)33-21-26(49-42(33)46(36)39-24(3)17-23(2)18-25(39)4)20-29-40(47)37-34(44)14-15-35(45)38(37)41(29)48/h5-21H,1-4H3 |
| InChIKey | ZOLKWOUDBQZERO-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.77 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|