C18H21NSe — CID 176826453
6,6,15,15-tetramethyl-11-selena-9-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),10(14),12-pentaene (PubChem CID 176826453) has the molecular formula C18H21NSe and a molecular weight of 330.33 g/mol. Its IUPAC name is 6,6,15,15-tetramethyl-11-selena-9-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),10(14),12-pentaene.
| Compound Name | 6,6,15,15-tetramethyl-11-selena-9-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),10(14),12-pentaene |
|---|---|
| PubChem CID | 176826453 |
| Molecular Formula | C18H21NSe |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 6,6,15,15-tetramethyl-11-selena-9-azatetracyclo[7.6.1.05,16.010,14]hexadeca-1,3,5(16),10(14),12-pentaene |
| SMILES | CC1(C)CCN2c3[se]ccc3C(C)(C)c3cccc1c32 |
| InChI | InChI=1S/C18H21NSe/c1-17(2)9-10-19-15-12(17)6-5-7-13(15)18(3,4)14-8-11-20-16(14)19/h5-8,11H,9-10H2,1-4H3 |
| InChIKey | YKRSXFCXDGNSHO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|