C22H23NOSe — CID 164816568
2-[2-(9,9-dimethylacridin-10-yl)selenophen-3-yl]propan-2-ol (PubChem CID 164816568) has the molecular formula C22H23NOSe and a molecular weight of 396.39 g/mol. Its IUPAC name is 2-[2-(9,9-dimethylacridin-10-yl)selenophen-3-yl]propan-2-ol.
| Compound Name | 2-[2-(9,9-dimethylacridin-10-yl)selenophen-3-yl]propan-2-ol |
|---|---|
| PubChem CID | 164816568 |
| Molecular Formula | C22H23NOSe |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 2-[2-(9,9-dimethylacridin-10-yl)selenophen-3-yl]propan-2-ol |
| SMILES | CC(C)(O)c1cc[se]c1N1c2ccccc2C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C22H23NOSe/c1-21(2)15-9-5-7-11-18(15)23(19-12-8-6-10-16(19)21)20-17(13-14-25-20)22(3,4)24/h5-14,24H,1-4H3 |
| InChIKey | AMHZUEXIQQHDEA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|