C69H42F15N3 — CID 135130813
10-[3,5-bis(9,9-dimethylacridin-10-yl)-2,4,6-tris(2,3,4,5,6-pentafluorophenyl)phenyl]-9,9-dimethylacridine (PubChem CID 135130813) has the molecular formula C69H42F15N3 and a molecular weight of 1198.09 g/mol. Its IUPAC name is 10-[3,5-bis(9,9-dimethylacridin-10-yl)-2,4,6-tris(2,3,4,5,6-pentafluorophenyl)phenyl]-9,9-dimethylacridine.
| Compound Name | 10-[3,5-bis(9,9-dimethylacridin-10-yl)-2,4,6-tris(2,3,4,5,6-pentafluorophenyl)phenyl]-9,9-dimethylacridine |
|---|---|
| PubChem CID | 135130813 |
| Molecular Formula | C69H42F15N3 |
| Molecular Weight | 1198.09 g/mol |
| Exact Mass | 1197.31 |
| IUPAC Name | 10-[3,5-bis(9,9-dimethylacridin-10-yl)-2,4,6-tris(2,3,4,5,6-pentafluorophenyl)phenyl]-9,9-dimethylacridine |
| SMILES | CC1(C)c2ccccc2N(c2c(-c3c(F)c(F)c(F)c(F)c3F)c(N3c4ccccc4C(C)(C)c4ccccc43)c(-c3c(F)c(F)c(F)c(F)c3F)c(N3c4ccccc4C(C)(C)c4ccccc43)c2-c2c(F)c(F)c(F)c(F)c2F)c2ccccc21 |
| InChI | InChI=1S/C69H42F15N3/c1-67(2)31-19-7-13-25-37(31)85(38-26-14-8-20-32(38)67)64-46(43-49(70)55(76)61(82)56(77)50(43)71)65(86-39-27-15-9-21-33(39)68(3,4)34-22-10-16-28-40(34)86)48(45-53(74)59(80)63(84)60(81)54(45)75)66(47(64)44-51(72)57(78)62(83)58(79)52(44)73)87-41-29-17-11-23-35(41)69(5,6)36-24-12-18-30-42(36)87/h7-30H,1-6H3 |
| InChIKey | UBWWSEBONWEBTN-UHFFFAOYSA-N |
| XLogP | 21.10 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1198.09 |
| LogP ≤ 5 | 21.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|